C12H17F3N2O2S — CID 115310595
N-(1-amino-2,3-dimethylbutan-2-yl)-2,3,4-trifluorobenzenesulfonamide (PubChem CID 115310595) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115310595 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2,3,4-trifluorobenzenesulfonamide |
| SMILES | CC(C)C(C)(CN)NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H17F3N2O2S/c1-7(2)12(3,6-16)17-20(18,19)9-5-4-8(13)10(14)11(9)15/h4-5,7,17H,6,16H2,1-3H3 |
| InChIKey | HOXGROYQKQGWAF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|