C12H19BrN2O2S — CID 113284014
N-(1-amino-2,3-dimethylbutan-2-yl)-2-bromobenzenesulfonamide (PubChem CID 113284014) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2-bromobenzenesulfonamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 113284014 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-bromobenzenesulfonamide |
| SMILES | CC(C)C(C)(CN)NS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H19BrN2O2S/c1-9(2)12(3,8-14)15-18(16,17)11-7-5-4-6-10(11)13/h4-7,9,15H,8,14H2,1-3H3 |
| InChIKey | OFWWODHMRKZFLZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |