C12H18ClFN2O2S — CID 63888195
N-[3-(aminomethyl)pentan-3-yl]-4-chloro-2-fluorobenzenesulfonamide (PubChem CID 63888195) has the molecular formula C12H18ClFN2O2S and a molecular weight of 308.81 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-chloro-2-fluorobenzenesulfonamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-chloro-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63888195 |
| Molecular Formula | C12H18ClFN2O2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-chloro-2-fluorobenzenesulfonamide |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H18ClFN2O2S/c1-3-12(4-2,8-15)16-19(17,18)11-6-5-9(13)7-10(11)14/h5-7,16H,3-4,8,15H2,1-2H3 |
| InChIKey | ZNXHGVRMAZCSNO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |