C11H13Br2NO2S — CID 115698660
2,5-dibromo-N-but-3-en-2-yl-4-methylbenzenesulfonamide (PubChem CID 115698660) has the molecular formula C11H13Br2NO2S and a molecular weight of 383.11 g/mol. Its IUPAC name is 2,5-dibromo-N-but-3-en-2-yl-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-but-3-en-2-yl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115698660 |
| Molecular Formula | C11H13Br2NO2S |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | 2,5-dibromo-N-but-3-en-2-yl-4-methylbenzenesulfonamide |
| SMILES | C=CC(C)NS(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C11H13Br2NO2S/c1-4-8(3)14-17(15,16)11-6-9(12)7(2)5-10(11)13/h4-6,8,14H,1H2,2-3H3 |
| InChIKey | RILQGRGLGWFHRV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|