C7H10BrNO2S2 — CID 70519707
5-bromo-N,N,4-trimethylthiophene-2-sulfonamide (PubChem CID 70519707) has the molecular formula C7H10BrNO2S2 and a molecular weight of 284.20 g/mol. Its IUPAC name is 5-bromo-N,N,4-trimethylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N,N,4-trimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 70519707 |
| Molecular Formula | C7H10BrNO2S2 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | 5-bromo-N,N,4-trimethylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C)sc1Br |
| InChI | InChI=1S/C7H10BrNO2S2/c1-5-4-6(12-7(5)8)13(10,11)9(2)3/h4H,1-3H3 |
| InChIKey | YHHFMDMQQJXONS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |