C9H13Br2NO2S2 — CID 106441810
5-bromo-N-(3-bromopropyl)-N,4-dimethylthiophene-2-sulfonamide (PubChem CID 106441810) has the molecular formula C9H13Br2NO2S2 and a molecular weight of 391.15 g/mol. Its IUPAC name is 5-bromo-N-(3-bromopropyl)-N,4-dimethylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(3-bromopropyl)-N,4-dimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106441810 |
| Molecular Formula | C9H13Br2NO2S2 |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 5-bromo-N-(3-bromopropyl)-N,4-dimethylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCCBr)sc1Br |
| InChI | InChI=1S/C9H13Br2NO2S2/c1-7-6-8(15-9(7)11)16(13,14)12(2)5-3-4-10/h6H,3-5H2,1-2H3 |
| InChIKey | IJGCUOPGCUKXAD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|