C13H19ClN2O2S2 — CID 80704428
4-chloro-3-[ethyl(2-methylpropyl)sulfamoyl]benzenecarbothioamide (PubChem CID 80704428) has the molecular formula C13H19ClN2O2S2 and a molecular weight of 334.89 g/mol. Its IUPAC name is 4-chloro-3-[ethyl(2-methylpropyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 4-chloro-3-[ethyl(2-methylpropyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 80704428 |
| Molecular Formula | C13H19ClN2O2S2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-chloro-3-[ethyl(2-methylpropyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CCN(CC(C)C)S(=O)(=O)c1cc(C(N)=S)ccc1Cl |
| InChI | InChI=1S/C13H19ClN2O2S2/c1-4-16(8-9(2)3)20(17,18)12-7-10(13(15)19)5-6-11(12)14/h5-7,9H,4,8H2,1-3H3,(H2,15,19) |
| InChIKey | IPMKUJDIJPNPMS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|