C11H12BrNO4 — CID 99699895
1-[(5-bromofuran-2-yl)methyl-methylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 99699895) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl-methylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl-methylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 99699895 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl-methylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)C1(C(=O)O)CC1 |
| InChI | InChI=1S/C11H12BrNO4/c1-13(6-7-2-3-8(12)17-7)9(14)11(4-5-11)10(15)16/h2-3H,4-6H2,1H3,(H,15,16) |
| InChIKey | DACKOTGKBVPKSY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|