C15H13ClFN3OS — CID 47084163
3-chloro-6-fluoro-N-[2-(1-methylimidazol-2-yl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 47084163) has the molecular formula C15H13ClFN3OS and a molecular weight of 337.81 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-[2-(1-methylimidazol-2-yl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-[2-(1-methylimidazol-2-yl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 47084163 |
| Molecular Formula | C15H13ClFN3OS |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-chloro-6-fluoro-N-[2-(1-methylimidazol-2-yl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cn1ccnc1CCNC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C15H13ClFN3OS/c1-20-7-6-18-12(20)4-5-19-15(21)14-13(16)10-3-2-9(17)8-11(10)22-14/h2-3,6-8H,4-5H2,1H3,(H,19,21) |
| InChIKey | PHXBWSZGTULRJZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |