C26H28BrN5O2 — CID 17319018
3-bromo-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-4-methoxybenzamide (PubChem CID 17319018) has the molecular formula C26H28BrN5O2 and a molecular weight of 522.45 g/mol. Its IUPAC name is 3-bromo-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17319018 |
| Molecular Formula | C26H28BrN5O2 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 3-bromo-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-4-methoxybenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4ccc(OC)c(Br)c4)cc3n2)c(C)c1 |
| InChI | InChI=1S/C26H28BrN5O2/c1-6-31(7-2)19-9-10-24(17(4)12-19)32-29-22-13-16(3)21(15-23(22)30-32)28-26(33)18-8-11-25(34-5)20(27)14-18/h8-15H,6-7H2,1-5H3,(H,28,33) |
| InChIKey | PLBWYYCJFJLHAU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|