C28H30BrN5O2 — CID 17319031
(E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]prop-2-enamide (PubChem CID 17319031) has the molecular formula C28H30BrN5O2 and a molecular weight of 548.49 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17319031 |
| Molecular Formula | C28H30BrN5O2 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)/C=C/c4cc(Br)ccc4OC)cc3n2)c(C)c1 |
| InChI | InChI=1S/C28H30BrN5O2/c1-6-33(7-2)22-10-11-26(19(4)14-22)34-31-24-15-18(3)23(17-25(24)32-34)30-28(35)13-8-20-16-21(29)9-12-27(20)36-5/h8-17H,6-7H2,1-5H3,(H,30,35)/b13-8+ |
| InChIKey | SJTWFFWIBBHNHG-MDWZMJQESA-N |
| XLogP | 6.31 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|