C20H22Cl3N5O — CID 17111135
2,2,2-trichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]acetamide (PubChem CID 17111135) has the molecular formula C20H22Cl3N5O and a molecular weight of 454.79 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]acetamide |
|---|---|
| PubChem CID | 17111135 |
| Molecular Formula | C20H22Cl3N5O |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2,2,2-trichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]acetamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)C(Cl)(Cl)Cl)cc3n2)c(C)c1 |
| InChI | InChI=1S/C20H22Cl3N5O/c1-5-27(6-2)14-7-8-18(13(4)9-14)28-25-16-10-12(3)15(11-17(16)26-28)24-19(29)20(21,22)23/h7-11H,5-6H2,1-4H3,(H,24,29) |
| InChIKey | RABSEJTVINJJEX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|