C29H27Cl2N5O2 — CID 17319015
5-(2,3-dichlorophenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]furan-2-carboxamide (PubChem CID 17319015) has the molecular formula C29H27Cl2N5O2 and a molecular weight of 548.47 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17319015 |
| Molecular Formula | C29H27Cl2N5O2 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]furan-2-carboxamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4ccc(-c5cccc(Cl)c5Cl)o4)cc3n2)c(C)c1 |
| InChI | InChI=1S/C29H27Cl2N5O2/c1-5-35(6-2)19-10-11-25(18(4)14-19)36-33-23-15-17(3)22(16-24(23)34-36)32-29(37)27-13-12-26(38-27)20-8-7-9-21(30)28(20)31/h7-16H,5-6H2,1-4H3,(H,32,37) |
| InChIKey | SJRYTCCXLFCZPN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|