C28H32N6O2S — CID 17316885
N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 17316885) has the molecular formula C28H32N6O2S and a molecular weight of 516.67 g/mol. Its IUPAC name is N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 17316885 |
| Molecular Formula | C28H32N6O2S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4cccc(C)c4OC)cc3n2)c(C)c1 |
| InChI | InChI=1S/C28H32N6O2S/c1-7-33(8-2)20-12-13-25(19(5)14-20)34-31-23-15-18(4)22(16-24(23)32-34)29-28(37)30-27(35)21-11-9-10-17(3)26(21)36-6/h9-16H,7-8H2,1-6H3,(H2,29,30,35,37) |
| InChIKey | WUQSJYCWBOMIHV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|