C24H23ClN6O3 — CID 3820209
2-chloro-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-5-nitrobenzamide (PubChem CID 3820209) has the molecular formula C24H23ClN6O3 and a molecular weight of 478.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 3820209 |
| Molecular Formula | C24H23ClN6O3 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-chloro-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-5-nitrobenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4cc([N+](=O)[O-])ccc4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C24H23ClN6O3/c1-4-29(5-2)16-6-8-17(9-7-16)30-27-22-12-15(3)21(14-23(22)28-30)26-24(32)19-13-18(31(33)34)10-11-20(19)25/h6-14H,4-5H2,1-3H3,(H,26,32) |
| InChIKey | ZQAXREMOLHUZHQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|