C24H21FN6O4 — CID 3909196
N-[2-(4-fluorophenyl)-6-methylbenzotriazol-5-yl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 3909196) has the molecular formula C24H21FN6O4 and a molecular weight of 476.47 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-6-methylbenzotriazol-5-yl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[2-(4-fluorophenyl)-6-methylbenzotriazol-5-yl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 3909196 |
| Molecular Formula | C24H21FN6O4 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)-6-methylbenzotriazol-5-yl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | Cc1cc2nn(-c3ccc(F)cc3)nc2cc1NC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H21FN6O4/c1-15-12-21-22(28-30(27-21)17-4-2-16(25)3-5-17)14-20(15)26-24(32)19-13-18(31(33)34)6-7-23(19)29-8-10-35-11-9-29/h2-7,12-14H,8-11H2,1H3,(H,26,32) |
| InChIKey | OIEGMIFDNDHGJB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|