C29H31N7O3S — CID 43913923
N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]-5-nitro-2-piperidin-1-ylbenzamide (PubChem CID 43913923) has the molecular formula C29H31N7O3S and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]-5-nitro-2-piperidin-1-ylbenzamide.
| Compound Name | N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]-5-nitro-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 43913923 |
| Molecular Formula | C29H31N7O3S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]-5-nitro-2-piperidin-1-ylbenzamide |
| SMILES | Cc1cc2nn(-c3ccc(C(C)C)cc3)nc2cc1NC(=S)NC(=O)c1cc([N+](=O)[O-])ccc1N1CCCCC1 |
| InChI | InChI=1S/C29H31N7O3S/c1-18(2)20-7-9-21(10-8-20)35-32-25-15-19(3)24(17-26(25)33-35)30-29(40)31-28(37)23-16-22(36(38)39)11-12-27(23)34-13-5-4-6-14-34/h7-12,15-18H,4-6,13-14H2,1-3H3,(H2,30,31,37,40) |
| InChIKey | ATBWDPGLLQBAKL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|