C27H30ClN5O2 — CID 23099238
2-(2-chloro-4,6-dimethylphenoxy)-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]acetamide (PubChem CID 23099238) has the molecular formula C27H30ClN5O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is 2-(2-chloro-4,6-dimethylphenoxy)-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]acetamide.
| Compound Name | 2-(2-chloro-4,6-dimethylphenoxy)-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]acetamide |
|---|---|
| PubChem CID | 23099238 |
| Molecular Formula | C27H30ClN5O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-(2-chloro-4,6-dimethylphenoxy)-N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]acetamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)COc4c(C)cc(C)cc4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C27H30ClN5O2/c1-6-32(7-2)20-8-10-21(11-9-20)33-30-24-14-18(4)23(15-25(24)31-33)29-26(34)16-35-27-19(5)12-17(3)13-22(27)28/h8-15H,6-7,16H2,1-5H3,(H,29,34) |
| InChIKey | RCVBDTBKEGLVEP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|