C26H23ClN4O3S — CID 17274561
N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide (PubChem CID 17274561) has the molecular formula C26H23ClN4O3S and a molecular weight of 507.02 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17274561 |
| Molecular Formula | C26H23ClN4O3S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)c1sc2c([N+](=O)[O-])cccc2c1Cl |
| InChI | InChI=1S/C26H23ClN4O3S/c27-23-21-7-4-8-22(31(33)34)24(21)35-25(23)26(32)28-19-9-11-20(12-10-19)30-15-13-29(14-16-30)17-18-5-2-1-3-6-18/h1-12H,13-17H2,(H,28,32) |
| InChIKey | YCRNJNQDMONGHD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|