C22H14Cl2N2O4S — CID 95733493
3-chloro-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide (PubChem CID 95733493) has the molecular formula C22H14Cl2N2O4S and a molecular weight of 473.34 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 95733493 |
| Molecular Formula | C22H14Cl2N2O4S |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 3-chloro-N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1[C@H](O)c1ccccc1)c1sc2c([N+](=O)[O-])cccc2c1Cl |
| InChI | InChI=1S/C22H14Cl2N2O4S/c23-13-9-10-16(15(11-13)19(27)12-5-2-1-3-6-12)25-22(28)21-18(24)14-7-4-8-17(26(29)30)20(14)31-21/h1-11,19,27H,(H,25,28)/t19-/m1/s1 |
| InChIKey | DFRVHDXFAURFPZ-LJQANCHMSA-N |
| XLogP | 6.45 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|