C20H18Cl2N2OS — CID 4643285
3-chloro-N-(3-chloro-2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 4643285) has the molecular formula C20H18Cl2N2OS and a molecular weight of 405.35 g/mol. Its IUPAC name is 3-chloro-N-(3-chloro-2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(3-chloro-2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4643285 |
| Molecular Formula | C20H18Cl2N2OS |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 3-chloro-N-(3-chloro-2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1N1CCCCC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H18Cl2N2OS/c21-14-8-6-9-15(18(14)24-11-4-1-5-12-24)23-20(25)19-17(22)13-7-2-3-10-16(13)26-19/h2-3,6-10H,1,4-5,11-12H2,(H,23,25) |
| InChIKey | YAHVNAKQYKSLJQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |