C21H24N4O4S — CID 22778838
N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3,4-dimethylbenzamide (PubChem CID 22778838) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 22778838 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3,4-dimethylbenzamide |
| SMILES | COc1ccc(N2CCN(C(=S)NC(=O)c3ccc(C)c(C)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-14-4-5-16(12-15(14)2)20(26)22-21(30)24-10-8-23(9-11-24)18-7-6-17(29-3)13-19(18)25(27)28/h4-7,12-13H,8-11H2,1-3H3,(H,22,26,30) |
| InChIKey | WXOFNADLYWZTME-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|