C25H33N5O3 — CID 46410589
N-[3-(4-benzylpiperazin-1-yl)propyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 46410589) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 46410589 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H33N5O3/c31-25(22-9-10-23(24(19-22)30(32)33)29-13-4-5-14-29)26-11-6-12-27-15-17-28(18-16-27)20-21-7-2-1-3-8-21/h1-3,7-10,19H,4-6,11-18,20H2,(H,26,31) |
| InChIKey | LNJGYDVLLJVIRD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|