C21H26N4O9S2 — CID 98366483
N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 98366483) has the molecular formula C21H26N4O9S2 and a molecular weight of 542.59 g/mol. Its IUPAC name is N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 98366483 |
| Molecular Formula | C21H26N4O9S2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | C[C@H]1CN(S(=O)(=O)CCNC(=O)c2cc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)ccc2O)C[C@H](C)O1 |
| InChI | InChI=1S/C21H26N4O9S2/c1-14-12-24(13-15(2)34-14)35(30,31)9-8-22-21(27)19-10-16(6-7-20(19)26)23-36(32,33)18-5-3-4-17(11-18)25(28)29/h3-7,10-11,14-15,23,26H,8-9,12-13H2,1-2H3,(H,22,27)/t14-,15-/m0/s1 |
| InChIKey | OZXKAEDGCWSYQE-GJZGRUSLSA-N |
| XLogP | 1.27 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|