C22H21N3O8S — CID 42959841
2-hydroxy-N-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-5-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 42959841) has the molecular formula C22H21N3O8S and a molecular weight of 487.49 g/mol. Its IUPAC name is 2-hydroxy-N-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-5-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | 2-hydroxy-N-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-5-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 42959841 |
| Molecular Formula | C22H21N3O8S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-hydroxy-N-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-5-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | COc1ccccc1C(O)CNC(=O)c1cc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C22H21N3O8S/c1-33-21-8-3-2-7-17(21)20(27)13-23-22(28)18-11-14(9-10-19(18)26)24-34(31,32)16-6-4-5-15(12-16)25(29)30/h2-12,20,24,26-27H,13H2,1H3,(H,23,28) |
| InChIKey | NQRWBQGXOSEPIA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|