C16H26N2O3S — CID 51119420
2-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(3-methylphenyl)methyl]ethanamine (PubChem CID 51119420) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(3-methylphenyl)methyl]ethanamine.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(3-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 51119420 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[(3-methylphenyl)methyl]ethanamine |
| SMILES | Cc1cccc(CNCCS(=O)(=O)N2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C16H26N2O3S/c1-13-5-4-6-16(9-13)10-17-7-8-22(19,20)18-11-14(2)21-15(3)12-18/h4-6,9,14-15,17H,7-8,10-12H2,1-3H3 |
| InChIKey | PERYKHIGPJLVSX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|