C14H26N2O4S — CID 94799434
(Z)-N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-methylpent-2-enamide (PubChem CID 94799434) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is (Z)-N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-methylpent-2-enamide.
| Compound Name | (Z)-N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 94799434 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (Z)-N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCCS(=O)(=O)N1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H26N2O4S/c1-5-6-11(2)14(17)15-7-8-21(18,19)16-9-12(3)20-13(4)10-16/h6,12-13H,5,7-10H2,1-4H3,(H,15,17)/b11-6-/t12-,13-/m0/s1 |
| InChIKey | LIOGAVCBSWZRKP-ISGXEFFDSA-N |
| XLogP | 0.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|