C15H28N2O2 — CID 102743359
azepan-1-yl-(2,2,6,6-tetramethylmorpholin-4-yl)methanone (PubChem CID 102743359) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is azepan-1-yl-(2,2,6,6-tetramethylmorpholin-4-yl)methanone.
| Compound Name | azepan-1-yl-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 102743359 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | azepan-1-yl-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)N2CCCCCC2)CC(C)(C)O1 |
| InChI | InChI=1S/C15H28N2O2/c1-14(2)11-17(12-15(3,4)19-14)13(18)16-9-7-5-6-8-10-16/h5-12H2,1-4H3 |
| InChIKey | KSYKHSSBKCRVBA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |