methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate

C9H18N2O2 — CID 115302351

IUPACmethyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate
SMILESCOC(=O)C(C)CN1CC[C@H](N)C1
InChIInChI=1S/C9H18N2O2/c1-7(9(12)13-2)5-11-4-3-8(10)6-11/h7-8H,3-6,10H2,1-2H3/t7?,8-/m0/s1
InChIKeyWSVJBGPQAAAWDI-MQWKRIRWSA-N
MW186.25 g/mol
LogP-0.17
Rot. Bonds3

About methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate

methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate (PubChem CID 115302351) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate.

Molecular Properties

Compound Namemethyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate
PubChem CID115302351
Molecular FormulaC9H18N2O2
Molecular Weight186.25 g/mol
Exact Mass186.14
IUPAC Namemethyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate
SMILESCOC(=O)C(C)CN1CC[C@H](N)C1
InChIInChI=1S/C9H18N2O2/c1-7(9(12)13-2)5-11-4-3-8(10)6-11/h7-8H,3-6,10H2,1-2H3/t7?,8-/m0/s1
InChIKeyWSVJBGPQAAAWDI-MQWKRIRWSA-N
XLogP-0.17
TPSA55.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 5-0.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate?
The IUPAC name of methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate (CID 115302351) is methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate.
What is the SMILES notation for methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate?
The canonical SMILES for methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate is COC(=O)C(C)CN1CC[C@H](N)C1.
What is the InChIKey of methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate?
The InChIKey is WSVJBGPQAAAWDI-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-7(9(12)13-2)5-11-4-3-8(10)6-11/h7-8H,3-6,10H2,1-2H3/t7?,8-/m0/s1.
What are the key properties of methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate?
methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate has a molecular weight of 186.25 g/mol, XLogP of -0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3S)-3-aminopyrrolidin-1-yl]-2-methylpropanoate is sourced from PubChem (CID 115302351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).