C13H25N3O3 — CID 115301996
methyl 2-[[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 115301996) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 2-[[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 115301996 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | methyl 2-[[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)CN1CC[C@@H](N)C1 |
| InChI | InChI=1S/C13H25N3O3/c1-9(2)6-11(13(18)19-3)15-12(17)8-16-5-4-10(14)7-16/h9-11H,4-8,14H2,1-3H3,(H,15,17)/t10-,11?/m1/s1 |
| InChIKey | ALNKWRVKUVKHSR-NFJWQWPMSA-N |
| XLogP | -0.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |