C12H25N3O — CID 61297413
2-(3-aminopiperidin-1-yl)-N-(3-methylbutan-2-yl)acetamide (PubChem CID 61297413) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(3-aminopiperidin-1-yl)-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 61297413 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(C)NC(=O)CN1CCCC(N)C1 |
| InChI | InChI=1S/C12H25N3O/c1-9(2)10(3)14-12(16)8-15-6-4-5-11(13)7-15/h9-11H,4-8,13H2,1-3H3,(H,14,16) |
| InChIKey | MQOAECQMQJZSPN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |