C14H30ClN3O — CID 119920920
2-[4-(1-aminoethyl)piperidin-1-yl]-N-(3-methylbutan-2-yl)acetamide;hydrochloride (PubChem CID 119920920) has the molecular formula C14H30ClN3O and a molecular weight of 291.87 g/mol. Its IUPAC name is 2-[4-(1-aminoethyl)piperidin-1-yl]-N-(3-methylbutan-2-yl)acetamide;hydrochloride.
| Compound Name | 2-[4-(1-aminoethyl)piperidin-1-yl]-N-(3-methylbutan-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119920920 |
| Molecular Formula | C14H30ClN3O |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 2-[4-(1-aminoethyl)piperidin-1-yl]-N-(3-methylbutan-2-yl)acetamide;hydrochloride |
| SMILES | CC(C)C(C)NC(=O)CN1CCC(C(C)N)CC1.Cl |
| InChI | InChI=1S/C14H29N3O.ClH/c1-10(2)12(4)16-14(18)9-17-7-5-13(6-8-17)11(3)15;/h10-13H,5-9,15H2,1-4H3,(H,16,18);1H |
| InChIKey | YMUCUXXYIWSVDZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |