C15H31N3O — CID 43556882
2-(4-aminopiperidin-1-yl)-N-(6-methylheptan-2-yl)acetamide (PubChem CID 43556882) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-(6-methylheptan-2-yl)acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-(6-methylheptan-2-yl)acetamide |
|---|---|
| PubChem CID | 43556882 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-(6-methylheptan-2-yl)acetamide |
| SMILES | CC(C)CCCC(C)NC(=O)CN1CCC(N)CC1 |
| InChI | InChI=1S/C15H31N3O/c1-12(2)5-4-6-13(3)17-15(19)11-18-9-7-14(16)8-10-18/h12-14H,4-11,16H2,1-3H3,(H,17,19) |
| InChIKey | SWFSSXNTIKQAHW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |