C14H27N3O — CID 81389820
2-(4-aminopiperidin-1-yl)-N-[(1R)-1-cyclopentylethyl]acetamide (PubChem CID 81389820) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-[(1R)-1-cyclopentylethyl]acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-[(1R)-1-cyclopentylethyl]acetamide |
|---|---|
| PubChem CID | 81389820 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-[(1R)-1-cyclopentylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN1CCC(N)CC1)C1CCCC1 |
| InChI | InChI=1S/C14H27N3O/c1-11(12-4-2-3-5-12)16-14(18)10-17-8-6-13(15)7-9-17/h11-13H,2-10,15H2,1H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | FPLOUTVMSMFJTG-LLVKDONJSA-N |
| XLogP | 1.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |