C10H21NO — CID 107319640
5-(3,3-dimethylazetidin-1-yl)pentan-1-ol (PubChem CID 107319640) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 5-(3,3-dimethylazetidin-1-yl)pentan-1-ol.
| Compound Name | 5-(3,3-dimethylazetidin-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 107319640 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 5-(3,3-dimethylazetidin-1-yl)pentan-1-ol |
| SMILES | CC1(C)CN(CCCCCO)C1 |
| InChI | InChI=1S/C10H21NO/c1-10(2)8-11(9-10)6-4-3-5-7-12/h12H,3-9H2,1-2H3 |
| InChIKey | BTPLSLVVRDEWLH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|