C16H34N2OV — CID 171637865
ethane;7-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)heptan-1-ol;vanadium (PubChem CID 171637865) has the molecular formula C16H34N2OV and a molecular weight of 321.41 g/mol. Its IUPAC name is ethane;7-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)heptan-1-ol;vanadium.
| Compound Name | ethane;7-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)heptan-1-ol;vanadium |
|---|---|
| PubChem CID | 171637865 |
| Molecular Formula | C16H34N2OV |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | ethane;7-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)heptan-1-ol;vanadium |
| SMILES | CC.CCN1CC2(C1)CN(CCCCCCCO)C2.[V] |
| InChI | InChI=1S/C14H28N2O.C2H6.V/c1-2-15-10-14(11-15)12-16(13-14)8-6-4-3-5-7-9-17;1-2;/h17H,2-13H2,1H3;1-2H3; |
| InChIKey | IVAIYMMVMFWWHL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|