C11H16N2O — CID 58095808
7-methoxy-1,2-dimethyl-3,4-dihydrocinnoline (PubChem CID 58095808) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 7-methoxy-1,2-dimethyl-3,4-dihydrocinnoline.
| Compound Name | 7-methoxy-1,2-dimethyl-3,4-dihydrocinnoline |
|---|---|
| PubChem CID | 58095808 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 7-methoxy-1,2-dimethyl-3,4-dihydrocinnoline |
| SMILES | COc1ccc2c(c1)N(C)N(C)CC2 |
| InChI | InChI=1S/C11H16N2O/c1-12-7-6-9-4-5-10(14-3)8-11(9)13(12)2/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | OTHOZDDDCSUIMN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |