C18H21NO2 — CID 69472084
6-methoxy-2-(4-methoxy-2-methylphenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 69472084) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 6-methoxy-2-(4-methoxy-2-methylphenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-methoxy-2-(4-methoxy-2-methylphenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 69472084 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 6-methoxy-2-(4-methoxy-2-methylphenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(N2CCc3cc(OC)ccc3C2)c(C)c1 |
| InChI | InChI=1S/C18H21NO2/c1-13-10-16(20-2)6-7-18(13)19-9-8-14-11-17(21-3)5-4-15(14)12-19/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | SZYBVNVUFFSCNT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|