C18H26F2N2O2 — CID 142387595
1-(4-aminopiperidin-1-yl)-3-(4-butoxyphenyl)-3,3-difluoropropan-1-one (PubChem CID 142387595) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-3-(4-butoxyphenyl)-3,3-difluoropropan-1-one.
| Compound Name | 1-(4-aminopiperidin-1-yl)-3-(4-butoxyphenyl)-3,3-difluoropropan-1-one |
|---|---|
| PubChem CID | 142387595 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-3-(4-butoxyphenyl)-3,3-difluoropropan-1-one |
| SMILES | CCCCOc1ccc(C(F)(F)CC(=O)N2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-2-3-12-24-16-6-4-14(5-7-16)18(19,20)13-17(23)22-10-8-15(21)9-11-22/h4-7,15H,2-3,8-13,21H2,1H3 |
| InChIKey | GSOBULLMMGUQSU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|