C22H30ClN5O3 — CID 146251901
tert-butyl N-[1-[5-[[6-chloro-4-(methylaminomethyl)-2-pyridinyl]oxy]-2-pyridinyl]piperidin-4-yl]carbamate (PubChem CID 146251901) has the molecular formula C22H30ClN5O3 and a molecular weight of 447.97 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[[6-chloro-4-(methylaminomethyl)-2-pyridinyl]oxy]-2-pyridinyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[[6-chloro-4-(methylaminomethyl)-2-pyridinyl]oxy]-2-pyridinyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 146251901 |
| Molecular Formula | C22H30ClN5O3 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | tert-butyl N-[1-[5-[[6-chloro-4-(methylaminomethyl)-2-pyridinyl]oxy]-2-pyridinyl]piperidin-4-yl]carbamate |
| SMILES | CNCc1cc(Cl)nc(Oc2ccc(N3CCC(NC(=O)OC(C)(C)C)CC3)nc2)c1 |
| InChI | InChI=1S/C22H30ClN5O3/c1-22(2,3)31-21(29)26-16-7-9-28(10-8-16)19-6-5-17(14-25-19)30-20-12-15(13-24-4)11-18(23)27-20/h5-6,11-12,14,16,24H,7-10,13H2,1-4H3,(H,26,29) |
| InChIKey | JQBMUGJAWUQMHQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|