C13H14ClF3N2O — CID 154686719
4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoyl chloride (PubChem CID 154686719) has the molecular formula C13H14ClF3N2O and a molecular weight of 306.72 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoyl chloride.
| Compound Name | 4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 154686719 |
| Molecular Formula | C13H14ClF3N2O |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)benzoyl chloride |
| SMILES | CN1CCN(c2ccc(C(=O)Cl)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14ClF3N2O/c1-18-4-6-19(7-5-18)11-3-2-9(12(14)20)8-10(11)13(15,16)17/h2-3,8H,4-7H2,1H3 |
| InChIKey | CKSGCRMSYOIVER-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|