C22H21F3N4O — CID 171512798
4-(4-methylpiperazin-1-yl)-N-quinolin-8-yl-3-(trifluoromethyl)benzamide (PubChem CID 171512798) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N-quinolin-8-yl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N-quinolin-8-yl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171512798 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N-quinolin-8-yl-3-(trifluoromethyl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3cccc4cccnc34)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H21F3N4O/c1-28-10-12-29(13-11-28)19-8-7-16(14-17(19)22(23,24)25)21(30)27-18-6-2-4-15-5-3-9-26-20(15)18/h2-9,14H,10-13H2,1H3,(H,27,30) |
| InChIKey | KSXDFZCVCMVPBA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |