C12H15F3N2 — CID 131995664
1-methyl-3-[4-methyl-2-(trifluoromethyl)phenyl]imidazolidine (PubChem CID 131995664) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-methyl-3-[4-methyl-2-(trifluoromethyl)phenyl]imidazolidine.
| Compound Name | 1-methyl-3-[4-methyl-2-(trifluoromethyl)phenyl]imidazolidine |
|---|---|
| PubChem CID | 131995664 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-methyl-3-[4-methyl-2-(trifluoromethyl)phenyl]imidazolidine |
| SMILES | Cc1ccc(N2CCN(C)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2/c1-9-3-4-11(10(7-9)12(13,14)15)17-6-5-16(2)8-17/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | DNCGCIFRBGHIDW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |