C12H13F4N3O2S — CID 175475658
(3R)-4-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-3-(sulfanylmethyl)piperazine-1-carboxylic acid (PubChem CID 175475658) has the molecular formula C12H13F4N3O2S and a molecular weight of 339.31 g/mol. Its IUPAC name is (3R)-4-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-3-(sulfanylmethyl)piperazine-1-carboxylic acid.
| Compound Name | (3R)-4-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-3-(sulfanylmethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175475658 |
| Molecular Formula | C12H13F4N3O2S |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (3R)-4-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-3-(sulfanylmethyl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ncc(C(F)(F)F)cc2F)[C@@H](CS)C1 |
| InChI | InChI=1S/C12H13F4N3O2S/c13-9-3-7(12(14,15)16)4-17-10(9)19-2-1-18(11(20)21)5-8(19)6-22/h3-4,8,22H,1-2,5-6H2,(H,20,21)/t8-/m1/s1 |
| InChIKey | HOBIGYZAERVFHJ-MRVPVSSYSA-N |
| XLogP | 2.34 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|