C20H23F3N4O2 — CID 170428570
2-[(2S)-4-benzyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperazin-2-yl]ethyl acetate (PubChem CID 170428570) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[(2S)-4-benzyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperazin-2-yl]ethyl acetate.
| Compound Name | 2-[(2S)-4-benzyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperazin-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 170428570 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[(2S)-4-benzyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperazin-2-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1CN(Cc2ccccc2)CCN1c1cnc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H23F3N4O2/c1-15(28)29-10-7-17-14-26(13-16-5-3-2-4-6-16)8-9-27(17)19-12-24-18(11-25-19)20(21,22)23/h2-6,11-12,17H,7-10,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | PVGJKDCLJYLOFO-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |