C16H21N3O2 — CID 59674842
[(2R)-4-benzyl-1-(5-methyl-1,2-oxazol-3-yl)piperazin-2-yl]methanol (PubChem CID 59674842) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(2R)-4-benzyl-1-(5-methyl-1,2-oxazol-3-yl)piperazin-2-yl]methanol.
| Compound Name | [(2R)-4-benzyl-1-(5-methyl-1,2-oxazol-3-yl)piperazin-2-yl]methanol |
|---|---|
| PubChem CID | 59674842 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [(2R)-4-benzyl-1-(5-methyl-1,2-oxazol-3-yl)piperazin-2-yl]methanol |
| SMILES | Cc1cc(N2CCN(Cc3ccccc3)C[C@@H]2CO)no1 |
| InChI | InChI=1S/C16H21N3O2/c1-13-9-16(17-21-13)19-8-7-18(11-15(19)12-20)10-14-5-3-2-4-6-14/h2-6,9,15,20H,7-8,10-12H2,1H3/t15-/m1/s1 |
| InChIKey | XNSVZDCFYHDYAY-OAHLLOKOSA-N |
| XLogP | 1.67 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |