C24H28N4O2 — CID 9488599
(E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enamide (PubChem CID 9488599) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9488599 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (E)-N-[(3R)-1-benzylpyrrolidin-3-yl]-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(-n2c(C)cc(/C=C/C(=O)N[C@@H]3CCN(Cc4ccccc4)C3)c2C)no1 |
| InChI | InChI=1S/C24H28N4O2/c1-17-13-21(19(3)28(17)23-14-18(2)30-26-23)9-10-24(29)25-22-11-12-27(16-22)15-20-7-5-4-6-8-20/h4-10,13-14,22H,11-12,15-16H2,1-3H3,(H,25,29)/b10-9+/t22-/m1/s1 |
| InChIKey | OZVNGXQWVZQPLA-DGSRBQDKSA-N |
| XLogP | 3.79 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|