C16H14BrF3N4O — CID 175596351
(2-bromophenyl)-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 175596351) has the molecular formula C16H14BrF3N4O and a molecular weight of 415.21 g/mol. Its IUPAC name is (2-bromophenyl)-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (2-bromophenyl)-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 175596351 |
| Molecular Formula | C16H14BrF3N4O |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (2-bromophenyl)-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Br)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H14BrF3N4O/c17-13-4-2-1-3-12(13)14(25)23-5-7-24(8-6-23)15-21-9-11(10-22-15)16(18,19)20/h1-4,9-10H,5-8H2 |
| InChIKey | BLUOOYWRFGRESP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |