C16H21F3N6O3 — CID 175596359
[1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbonyl]piperidin-3-yl] carbamate (PubChem CID 175596359) has the molecular formula C16H21F3N6O3 and a molecular weight of 402.38 g/mol. Its IUPAC name is [1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbonyl]piperidin-3-yl] carbamate.
| Compound Name | [1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbonyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175596359 |
| Molecular Formula | C16H21F3N6O3 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbonyl]piperidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCCN(C(=O)N2CCN(c3ncc(C(F)(F)F)cn3)CC2)C1 |
| InChI | InChI=1S/C16H21F3N6O3/c17-16(18,19)11-8-21-14(22-9-11)23-4-6-24(7-5-23)15(27)25-3-1-2-12(10-25)28-13(20)26/h8-9,12H,1-7,10H2,(H2,20,26) |
| InChIKey | TXEPEVTUGFWPRA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |