C24H27F3N4O3 — CID 154971350
1-[(3R)-1-[4-(3-hydroxypiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 154971350) has the molecular formula C24H27F3N4O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is 1-[(3R)-1-[4-(3-hydroxypiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R)-1-[4-(3-hydroxypiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 154971350 |
| Molecular Formula | C24H27F3N4O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[(3R)-1-[4-(3-hydroxypiperidin-1-yl)phenyl]-2-oxopiperidin-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N[C@@H]1CCCN(c2ccc(N3CCCC(O)C3)cc2)C1=O |
| InChI | InChI=1S/C24H27F3N4O3/c25-24(26,27)16-5-7-17(8-6-16)28-23(34)29-21-4-2-14-31(22(21)33)19-11-9-18(10-12-19)30-13-1-3-20(32)15-30/h5-12,20-21,32H,1-4,13-15H2,(H2,28,29,34)/t20?,21-/m1/s1 |
| InChIKey | FTUHLSSRPCGVCN-BPGUCPLFSA-N |
| XLogP | 3.98 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|